| |
A B C D E F G H I J K L M N O P Q R S T U V W X Y Z Misc
Benzil| Benzil | | | | General |
|---|
| Systematic name | 1,2-diphenylethanedione | | Other names | dibenzoyl
bibenzoyl
diphenylglyoxal | | Molecular formula | C14H10O2 | | SMILES | O=C(C(=O)c1ccccc1)c2ccccc2 | | Molar mass | 210.23 g/mol | | Appearance | yellow crystals or powder | | CAS number | [134-81-6] | | Properties |
|---|
| Density and phase | 1.23 g/cm3, solid | | Solubility in water | insoluble | | Solubility in ethanol | soluble | | Solubility in diethyl ether | soluble | | Solubility in benzene | soluble | | Melting point | 94-95 °C (367-368 K) | | Boiling point | 346-348 °C (619-621 K) | | Structure |
|---|
| Crystal structure | P31,221 Acta Cryst. B43 398 (1987) | | Dipole moment | ? D | | Hazards |
|---|
| MSDS | External MSDS | | Main hazards | ? | | NFPA 704 | | | Flash point | ? °C | | R/S statement | R: ?
S: ? | | RTECS number | ? | | Supplementary data page |
|---|
Structure and
properties | n, εr, etc. | Thermodynamic
data | Phase behaviour
Solid, liquid, gas | | Spectral data | UV, IR, NMR, MS | | Related compounds |
|---|
| Related diketones | ? | | Related compounds | benzophenone
glyoxal | Except where noted otherwise, data are given for
materials in their standard state (at 25 °C, 100 kPa)
Infobox disclaimer and references | |
Benzil is a diketone that is used as an intermediate in organic synthesis. Benzil can be prepared in the laboratory by the benzoin condensation of benzaldehyde followed by oxidation of benzoin. A classical organic reaction of benzil is the Benzilic acid rearrangement to benzilic acid.
|
|
